C26H24F3N3O4 — CID 2900161
2,7,7-trimethyl-4-(4-nitrophenyl)-5-oxo-N-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrahydroquinoline-3-carboxamide (PubChem CID 2900161) has the molecular formula C26H24F3N3O4 and a molecular weight of 499.49 g/mol. Its IUPAC name is 2,7,7-trimethyl-4-(4-nitrophenyl)-5-oxo-N-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | 2,7,7-trimethyl-4-(4-nitrophenyl)-5-oxo-N-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 2900161 |
| Molecular Formula | C26H24F3N3O4 |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 2,7,7-trimethyl-4-(4-nitrophenyl)-5-oxo-N-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrahydroquinoline-3-carboxamide |
| SMILES | CC1=C(C(=O)Nc2cccc(C(F)(F)F)c2)C(c2ccc([N+](=O)[O-])cc2)C2=C(CC(C)(C)CC2=O)N1 |
| InChI | InChI=1S/C26H24F3N3O4/c1-14-21(24(34)31-17-6-4-5-16(11-17)26(27,28)29)22(15-7-9-18(10-8-15)32(35)36)23-19(30-14)12-25(2,3)13-20(23)33/h4-11,22,30H,12-13H2,1-3H3,(H,31,34) |
| InChIKey | LKKMQSUSMLWANG-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|