C8H8F4N2O — CID 29004293
6-(2,2,3,3-tetrafluoropropoxy)pyridin-3-amine (PubChem CID 29004293) has the molecular formula C8H8F4N2O and a molecular weight of 224.16 g/mol. Its IUPAC name is 6-(2,2,3,3-tetrafluoropropoxy)pyridin-3-amine.
| Compound Name | 6-(2,2,3,3-tetrafluoropropoxy)pyridin-3-amine |
|---|---|
| PubChem CID | 29004293 |
| Molecular Formula | C8H8F4N2O |
| Molecular Weight | 224.16 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 6-(2,2,3,3-tetrafluoropropoxy)pyridin-3-amine |
| SMILES | Nc1ccc(OCC(F)(F)C(F)F)nc1 |
| InChI | InChI=1S/C8H8F4N2O/c9-7(10)8(11,12)4-15-6-2-1-5(13)3-14-6/h1-3,7H,4,13H2 |
| InChIKey | XDHROHIHKBDPTB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.16 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|