C11H12F4N2O — CID 29004870
2-(2,2,3,3-tetrafluoropropoxymethyl)benzenecarboximidamide (PubChem CID 29004870) has the molecular formula C11H12F4N2O and a molecular weight of 264.22 g/mol. Its IUPAC name is 2-(2,2,3,3-tetrafluoropropoxymethyl)benzenecarboximidamide.
| Compound Name | 2-(2,2,3,3-tetrafluoropropoxymethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 29004870 |
| Molecular Formula | C11H12F4N2O |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-(2,2,3,3-tetrafluoropropoxymethyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccccc1COCC(F)(F)C(F)F |
| InChI | InChI=1S/C11H12F4N2O/c12-10(13)11(14,15)6-18-5-7-3-1-2-4-8(7)9(16)17/h1-4,10H,5-6H2,(H3,16,17) |
| InChIKey | GEODUGNLGUKTNY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|