C11H12BrF4N — CID 29005260
4-bromo-2,6-dimethyl-N-(2,2,3,3-tetrafluoropropyl)aniline (PubChem CID 29005260) has the molecular formula C11H12BrF4N and a molecular weight of 314.12 g/mol. Its IUPAC name is 4-bromo-2,6-dimethyl-N-(2,2,3,3-tetrafluoropropyl)aniline.
| Compound Name | 4-bromo-2,6-dimethyl-N-(2,2,3,3-tetrafluoropropyl)aniline |
|---|---|
| PubChem CID | 29005260 |
| Molecular Formula | C11H12BrF4N |
| Molecular Weight | 314.12 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | 4-bromo-2,6-dimethyl-N-(2,2,3,3-tetrafluoropropyl)aniline |
| SMILES | Cc1cc(Br)cc(C)c1NCC(F)(F)C(F)F |
| InChI | InChI=1S/C11H12BrF4N/c1-6-3-8(12)4-7(2)9(6)17-5-11(15,16)10(13)14/h3-4,10,17H,5H2,1-2H3 |
| InChIKey | BGCMSTOFRZKELG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.12 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|