5-but-3-enoxypentanoic acid

C9H16O3 — CID 29005829

IUPAC5-but-3-enoxypentanoic acid
SMILESC=CCCOCCCCC(=O)O
InChIInChI=1S/C9H16O3/c1-2-3-7-12-8-5-4-6-9(10)11/h2H,1,3-8H2,(H,10,11)
InChIKeyQSCMUZIHJCWEHH-UHFFFAOYSA-N
MW172.22 g/mol
LogP1.83
Rot. Bonds8

About 5-but-3-enoxypentanoic acid

5-but-3-enoxypentanoic acid (PubChem CID 29005829) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is 5-but-3-enoxypentanoic acid.

Molecular Properties

Compound Name5-but-3-enoxypentanoic acid
PubChem CID29005829
Molecular FormulaC9H16O3
Molecular Weight172.22 g/mol
Exact Mass172.11
IUPAC Name5-but-3-enoxypentanoic acid
SMILESC=CCCOCCCCC(=O)O
InChIInChI=1S/C9H16O3/c1-2-3-7-12-8-5-4-6-9(10)11/h2H,1,3-8H2,(H,10,11)
InChIKeyQSCMUZIHJCWEHH-UHFFFAOYSA-N
XLogP1.83
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds8
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.22
LogP ≤ 51.83
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 5-but-3-enoxypentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-but-3-enoxypentanoic acid?
The IUPAC name of 5-but-3-enoxypentanoic acid (CID 29005829) is 5-but-3-enoxypentanoic acid.
What is the SMILES notation for 5-but-3-enoxypentanoic acid?
The canonical SMILES for 5-but-3-enoxypentanoic acid is C=CCCOCCCCC(=O)O.
What is the InChIKey of 5-but-3-enoxypentanoic acid?
The InChIKey is QSCMUZIHJCWEHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3/c1-2-3-7-12-8-5-4-6-9(10)11/h2H,1,3-8H2,(H,10,11).
What are the key properties of 5-but-3-enoxypentanoic acid?
5-but-3-enoxypentanoic acid has a molecular weight of 172.22 g/mol, XLogP of 1.83, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-but-3-enoxypentanoic acid is sourced from PubChem (CID 29005829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).