C23H19ClN4O2 — CID 29011530
1-benzyl-3-[(R)-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-phenylmethyl]urea (PubChem CID 29011530) has the molecular formula C23H19ClN4O2 and a molecular weight of 418.88 g/mol. Its IUPAC name is 1-benzyl-3-[(R)-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-phenylmethyl]urea.
| Compound Name | 1-benzyl-3-[(R)-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-phenylmethyl]urea |
|---|---|
| PubChem CID | 29011530 |
| Molecular Formula | C23H19ClN4O2 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 1-benzyl-3-[(R)-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-phenylmethyl]urea |
| SMILES | O=C(NCc1ccccc1)N[C@H](c1ccccc1)c1nnc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C23H19ClN4O2/c24-19-13-11-18(12-14-19)21-27-28-22(30-21)20(17-9-5-2-6-10-17)26-23(29)25-15-16-7-3-1-4-8-16/h1-14,20H,15H2,(H2,25,26,29)/t20-/m1/s1 |
| InChIKey | WYXFWOHPHGCPNS-HXUWFJFHSA-N |
| XLogP | 4.98 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |