About methyl 5-[(butan-2-ylamino)methyl]furan-2-carboxylate;hydrochloride
methyl 5-[(butan-2-ylamino)methyl]furan-2-carboxylate;hydrochloride (PubChem CID 2901182) has the molecular formula C11H18ClNO3
and a molecular weight of 247.72 g/mol. Its IUPAC name is methyl 5-[(butan-2-ylamino)methyl]furan-2-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | methyl 5-[(butan-2-ylamino)methyl]furan-2-carboxylate;hydrochloride |
| PubChem CID | 2901182 |
| Molecular Formula | C11H18ClNO3 |
| Molecular Weight | 247.72 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | methyl 5-[(butan-2-ylamino)methyl]furan-2-carboxylate;hydrochloride |
| SMILES | CCC(C)NCc1ccc(C(=O)OC)o1.Cl |
| InChI | InChI=1S/C11H17NO3.ClH/c1-4-8(2)12-7-9-5-6-10(15-9)11(13)14-3;/h5-6,8,12H,4,7H2,1-3H3;1H |
| InChIKey | OTYZBYXMUWLJJB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.72 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 5-[(butan-2-ylamino)methyl]furan-2-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[(butan-2-ylamino)methyl]furan-2-carboxylate;hydrochloride?
The IUPAC name of methyl 5-[(butan-2-ylamino)methyl]furan-2-carboxylate;hydrochloride (CID 2901182) is methyl 5-[(butan-2-ylamino)methyl]furan-2-carboxylate;hydrochloride.
What is the SMILES notation for methyl 5-[(butan-2-ylamino)methyl]furan-2-carboxylate;hydrochloride?
The canonical SMILES for methyl 5-[(butan-2-ylamino)methyl]furan-2-carboxylate;hydrochloride is CCC(C)NCc1ccc(C(=O)OC)o1.Cl.
What is the InChIKey of methyl 5-[(butan-2-ylamino)methyl]furan-2-carboxylate;hydrochloride?
The InChIKey is OTYZBYXMUWLJJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO3.ClH/c1-4-8(2)12-7-9-5-6-10(15-9)11(13)14-3;/h5-6,8,12H,4,7H2,1-3H3;1H.
What are the key properties of methyl 5-[(butan-2-ylamino)methyl]furan-2-carboxylate;hydrochloride?
methyl 5-[(butan-2-ylamino)methyl]furan-2-carboxylate;hydrochloride has a molecular weight of 247.72 g/mol, XLogP of 2.38, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(butan-2-ylamino)methyl]furan-2-carboxylate;hydrochloride is sourced from PubChem (CID 2901182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).