C23H27ClN6O3 — CID 2901943
N-(3-chloro-4-methoxyphenyl)-4-ethoxy-6-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-amine (PubChem CID 2901943) has the molecular formula C23H27ClN6O3 and a molecular weight of 470.96 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-4-ethoxy-6-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-amine.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-4-ethoxy-6-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 2901943 |
| Molecular Formula | C23H27ClN6O3 |
| Molecular Weight | 470.96 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-4-ethoxy-6-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-amine |
| SMILES | CCOc1nc(Nc2ccc(OC)c(Cl)c2)nc(N2CCN(c3ccc(OC)cc3)CC2)n1 |
| InChI | InChI=1S/C23H27ClN6O3/c1-4-33-23-27-21(25-16-5-10-20(32-3)19(24)15-16)26-22(28-23)30-13-11-29(12-14-30)17-6-8-18(31-2)9-7-17/h5-10,15H,4,11-14H2,1-3H3,(H,25,26,27,28) |
| InChIKey | MLCOUDSAHVZGSZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 84.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.96 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|