C10H12N2OS — CID 29021484
4-(2-aminoethyl)-1,4-benzothiazin-3-one (PubChem CID 29021484) has the molecular formula C10H12N2OS and a molecular weight of 208.29 g/mol. Its IUPAC name is 4-(2-aminoethyl)-1,4-benzothiazin-3-one.
| Compound Name | 4-(2-aminoethyl)-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 29021484 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 4-(2-aminoethyl)-1,4-benzothiazin-3-one |
| SMILES | NCCN1C(=O)CSc2ccccc21 |
| InChI | InChI=1S/C10H12N2OS/c11-5-6-12-8-3-1-2-4-9(8)14-7-10(12)13/h1-4H,5-7,11H2 |
| InChIKey | HKZYDEICXLLPBH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |