C9H7N7OS — CID 29022051
(10-oxo-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)thiourea (PubChem CID 29022051) has the molecular formula C9H7N7OS and a molecular weight of 261.27 g/mol. Its IUPAC name is (10-oxo-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)thiourea.
| Compound Name | (10-oxo-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)thiourea |
|---|---|
| PubChem CID | 29022051 |
| Molecular Formula | C9H7N7OS |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | (10-oxo-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)thiourea |
| SMILES | NC(=S)Nn1ccc2c(cnc3ncnn32)c1=O |
| InChI | InChI=1S/C9H7N7OS/c10-8(18)14-15-2-1-6-5(7(15)17)3-11-9-12-4-13-16(6)9/h1-4H,(H3,10,14,18) |
| InChIKey | DXCLWGUZJGRTDR-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 103.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|