C23H24N4O — CID 29023361
(E)-N-[(4S)-1-(3,5-dimethylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]-3-pyridin-2-ylprop-2-enamide (PubChem CID 29023361) has the molecular formula C23H24N4O and a molecular weight of 372.47 g/mol. Its IUPAC name is (E)-N-[(4S)-1-(3,5-dimethylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]-3-pyridin-2-ylprop-2-enamide.
| Compound Name | (E)-N-[(4S)-1-(3,5-dimethylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]-3-pyridin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 29023361 |
| Molecular Formula | C23H24N4O |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | (E)-N-[(4S)-1-(3,5-dimethylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]-3-pyridin-2-ylprop-2-enamide |
| SMILES | Cc1cc(C)cc(-n2ncc3c2CCC[C@@H]3NC(=O)/C=C/c2ccccn2)c1 |
| InChI | InChI=1S/C23H24N4O/c1-16-12-17(2)14-19(13-16)27-22-8-5-7-21(20(22)15-25-27)26-23(28)10-9-18-6-3-4-11-24-18/h3-4,6,9-15,21H,5,7-8H2,1-2H3,(H,26,28)/b10-9+/t21-/m0/s1 |
| InChIKey | VWAILEXUMJAJKP-GLCJEOIMSA-N |
| XLogP | 4.09 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|