C19H22N2O2S — CID 29023726
thiophen-2-yl-[4-(2,4,5-trimethylbenzoyl)piperazin-1-yl]methanone (PubChem CID 29023726) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is thiophen-2-yl-[4-(2,4,5-trimethylbenzoyl)piperazin-1-yl]methanone.
| Compound Name | thiophen-2-yl-[4-(2,4,5-trimethylbenzoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 29023726 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | thiophen-2-yl-[4-(2,4,5-trimethylbenzoyl)piperazin-1-yl]methanone |
| SMILES | Cc1cc(C)c(C(=O)N2CCN(C(=O)c3cccs3)CC2)cc1C |
| InChI | InChI=1S/C19H22N2O2S/c1-13-11-15(3)16(12-14(13)2)18(22)20-6-8-21(9-7-20)19(23)17-5-4-10-24-17/h4-5,10-12H,6-9H2,1-3H3 |
| InChIKey | RCUQCXWKTMGCMD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |