C11H13N3S2 — CID 2902374
4-(2,4-dimethyl-1,3-thiazol-5-yl)-N-prop-2-enyl-1,3-thiazol-2-amine (PubChem CID 2902374) has the molecular formula C11H13N3S2 and a molecular weight of 251.38 g/mol. Its IUPAC name is 4-(2,4-dimethyl-1,3-thiazol-5-yl)-N-prop-2-enyl-1,3-thiazol-2-amine.
| Compound Name | 4-(2,4-dimethyl-1,3-thiazol-5-yl)-N-prop-2-enyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 2902374 |
| Molecular Formula | C11H13N3S2 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 4-(2,4-dimethyl-1,3-thiazol-5-yl)-N-prop-2-enyl-1,3-thiazol-2-amine |
| SMILES | C=CCNc1nc(-c2sc(C)nc2C)cs1 |
| InChI | InChI=1S/C11H13N3S2/c1-4-5-12-11-14-9(6-15-11)10-7(2)13-8(3)16-10/h4,6H,1,5H2,2-3H3,(H,12,14) |
| InChIKey | LMAHHBKFCGDMKK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|