About 2-[(2S)-4-(1,4-dithiepan-6-yl)-1-propan-2-ylpiperazin-2-yl]ethanol
2-[(2S)-4-(1,4-dithiepan-6-yl)-1-propan-2-ylpiperazin-2-yl]ethanol (PubChem CID 29025041) has the molecular formula C14H28N2OS2
and a molecular weight of 304.53 g/mol. Its IUPAC name is 2-[(2S)-4-(1,4-dithiepan-6-yl)-1-propan-2-ylpiperazin-2-yl]ethanol.
Molecular Properties
| Compound Name | 2-[(2S)-4-(1,4-dithiepan-6-yl)-1-propan-2-ylpiperazin-2-yl]ethanol |
| PubChem CID | 29025041 |
| Molecular Formula | C14H28N2OS2 |
| Molecular Weight | 304.53 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 2-[(2S)-4-(1,4-dithiepan-6-yl)-1-propan-2-ylpiperazin-2-yl]ethanol |
| SMILES | CC(C)N1CCN(C2CSCCSC2)C[C@@H]1CCO |
| InChI | InChI=1S/C14H28N2OS2/c1-12(2)16-5-4-15(9-13(16)3-6-17)14-10-18-7-8-19-11-14/h12-14,17H,3-11H2,1-2H3/t13-/m0/s1 |
| InChIKey | GUDLXTFNNCOYNM-ZDUSSCGKSA-N |
| XLogP | 1.61 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.53 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2S)-4-(1,4-dithiepan-6-yl)-1-propan-2-ylpiperazin-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-4-(1,4-dithiepan-6-yl)-1-propan-2-ylpiperazin-2-yl]ethanol?
The IUPAC name of 2-[(2S)-4-(1,4-dithiepan-6-yl)-1-propan-2-ylpiperazin-2-yl]ethanol (CID 29025041) is 2-[(2S)-4-(1,4-dithiepan-6-yl)-1-propan-2-ylpiperazin-2-yl]ethanol.
What is the SMILES notation for 2-[(2S)-4-(1,4-dithiepan-6-yl)-1-propan-2-ylpiperazin-2-yl]ethanol?
The canonical SMILES for 2-[(2S)-4-(1,4-dithiepan-6-yl)-1-propan-2-ylpiperazin-2-yl]ethanol is CC(C)N1CCN(C2CSCCSC2)C[C@@H]1CCO.
What is the InChIKey of 2-[(2S)-4-(1,4-dithiepan-6-yl)-1-propan-2-ylpiperazin-2-yl]ethanol?
The InChIKey is GUDLXTFNNCOYNM-ZDUSSCGKSA-N. The full InChI is InChI=1S/C14H28N2OS2/c1-12(2)16-5-4-15(9-13(16)3-6-17)14-10-18-7-8-19-11-14/h12-14,17H,3-11H2,1-2H3/t13-/m0/s1.
What are the key properties of 2-[(2S)-4-(1,4-dithiepan-6-yl)-1-propan-2-ylpiperazin-2-yl]ethanol?
2-[(2S)-4-(1,4-dithiepan-6-yl)-1-propan-2-ylpiperazin-2-yl]ethanol has a molecular weight of 304.53 g/mol, XLogP of 1.61, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-4-(1,4-dithiepan-6-yl)-1-propan-2-ylpiperazin-2-yl]ethanol is sourced from PubChem (CID 29025041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).