C16H21N5O2 — CID 29026517
6-(2-methylprop-2-enylamino)-N-[(5-propan-2-yl-1,2,4-oxadiazol-3-yl)methyl]pyridine-3-carboxamide (PubChem CID 29026517) has the molecular formula C16H21N5O2 and a molecular weight of 315.38 g/mol. Its IUPAC name is 6-(2-methylprop-2-enylamino)-N-[(5-propan-2-yl-1,2,4-oxadiazol-3-yl)methyl]pyridine-3-carboxamide.
| Compound Name | 6-(2-methylprop-2-enylamino)-N-[(5-propan-2-yl-1,2,4-oxadiazol-3-yl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 29026517 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 6-(2-methylprop-2-enylamino)-N-[(5-propan-2-yl-1,2,4-oxadiazol-3-yl)methyl]pyridine-3-carboxamide |
| SMILES | C=C(C)CNc1ccc(C(=O)NCc2noc(C(C)C)n2)cn1 |
| InChI | InChI=1S/C16H21N5O2/c1-10(2)7-17-13-6-5-12(8-18-13)15(22)19-9-14-20-16(11(3)4)23-21-14/h5-6,8,11H,1,7,9H2,2-4H3,(H,17,18)(H,19,22) |
| InChIKey | GIGWNKCRJRMTDZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|