C17H15N5O2S — CID 2902690
[3-(3-nitrophenyl)-1-phenylpyrazol-4-yl]methyl carbamimidothioate (PubChem CID 2902690) has the molecular formula C17H15N5O2S and a molecular weight of 353.41 g/mol. Its IUPAC name is [3-(3-nitrophenyl)-1-phenylpyrazol-4-yl]methyl carbamimidothioate.
| Compound Name | [3-(3-nitrophenyl)-1-phenylpyrazol-4-yl]methyl carbamimidothioate |
|---|---|
| PubChem CID | 2902690 |
| Molecular Formula | C17H15N5O2S |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | [3-(3-nitrophenyl)-1-phenylpyrazol-4-yl]methyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCc1cn(-c2ccccc2)nc1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H15N5O2S/c18-17(19)25-11-13-10-21(14-6-2-1-3-7-14)20-16(13)12-5-4-8-15(9-12)22(23)24/h1-10H,11H2,(H3,18,19) |
| InChIKey | RKRBILSXWPKFNX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 110.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|