C13H7Cl4NO6 — CID 2902838
2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)pentanedioic acid (PubChem CID 2902838) has the molecular formula C13H7Cl4NO6 and a molecular weight of 415.01 g/mol. Its IUPAC name is 2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)pentanedioic acid.
| Compound Name | 2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)pentanedioic acid |
|---|---|
| PubChem CID | 2902838 |
| Molecular Formula | C13H7Cl4NO6 |
| Molecular Weight | 415.01 g/mol |
| Exact Mass | 412.90 |
| IUPAC Name | 2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)pentanedioic acid |
| SMILES | O=C(O)CCC(C(=O)O)N1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C13H7Cl4NO6/c14-7-5-6(8(15)10(17)9(7)16)12(22)18(11(5)21)3(13(23)24)1-2-4(19)20/h3H,1-2H2,(H,19,20)(H,23,24) |
| InChIKey | HMHCAARMFSEIIZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.01 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|