C13H17N3S — CID 2903039
N'-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-N,N-dimethylmethanimidamide (PubChem CID 2903039) has the molecular formula C13H17N3S and a molecular weight of 247.37 g/mol. Its IUPAC name is N'-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 2903039 |
| Molecular Formula | C13H17N3S |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | N'-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-N,N-dimethylmethanimidamide |
| SMILES | CN(C)C=Nc1sc2c(c1C#N)CCCCC2 |
| InChI | InChI=1S/C13H17N3S/c1-16(2)9-15-13-11(8-14)10-6-4-3-5-7-12(10)17-13/h9H,3-7H2,1-2H3 |
| InChIKey | JEIAUYARXNNCFA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|