About N-(4-anilinophenyl)-3,4,5-trimethoxybenzamide
N-(4-anilinophenyl)-3,4,5-trimethoxybenzamide (PubChem CID 2903122) has the molecular formula C22H22N2O4
and a molecular weight of 378.43 g/mol. Its IUPAC name is N-(4-anilinophenyl)-3,4,5-trimethoxybenzamide.
Molecular Properties
| Compound Name | N-(4-anilinophenyl)-3,4,5-trimethoxybenzamide |
| PubChem CID | 2903122 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N-(4-anilinophenyl)-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(Nc3ccccc3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C22H22N2O4/c1-26-19-13-15(14-20(27-2)21(19)28-3)22(25)24-18-11-9-17(10-12-18)23-16-7-5-4-6-8-16/h4-14,23H,1-3H3,(H,24,25) |
| InChIKey | WWBIVDAPTKYFBS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4-anilinophenyl)-3,4,5-trimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-anilinophenyl)-3,4,5-trimethoxybenzamide?
The IUPAC name of N-(4-anilinophenyl)-3,4,5-trimethoxybenzamide (CID 2903122) is N-(4-anilinophenyl)-3,4,5-trimethoxybenzamide.
What is the SMILES notation for N-(4-anilinophenyl)-3,4,5-trimethoxybenzamide?
The canonical SMILES for N-(4-anilinophenyl)-3,4,5-trimethoxybenzamide is COc1cc(C(=O)Nc2ccc(Nc3ccccc3)cc2)cc(OC)c1OC.
What is the InChIKey of N-(4-anilinophenyl)-3,4,5-trimethoxybenzamide?
The InChIKey is WWBIVDAPTKYFBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N2O4/c1-26-19-13-15(14-20(27-2)21(19)28-3)22(25)24-18-11-9-17(10-12-18)23-16-7-5-4-6-8-16/h4-14,23H,1-3H3,(H,24,25).
What are the key properties of N-(4-anilinophenyl)-3,4,5-trimethoxybenzamide?
N-(4-anilinophenyl)-3,4,5-trimethoxybenzamide has a molecular weight of 378.43 g/mol, XLogP of 4.71, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-anilinophenyl)-3,4,5-trimethoxybenzamide is sourced from PubChem (CID 2903122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).