About N-(5-methyl-4-oxo-1,3-thiazol-2-yl)-2-phenoxyacetamide
N-(5-methyl-4-oxo-1,3-thiazol-2-yl)-2-phenoxyacetamide (PubChem CID 2903852) has the molecular formula C12H12N2O3S
and a molecular weight of 264.31 g/mol. Its IUPAC name is N-(5-methyl-4-oxo-1,3-thiazol-2-yl)-2-phenoxyacetamide.
Molecular Properties
| Compound Name | N-(5-methyl-4-oxo-1,3-thiazol-2-yl)-2-phenoxyacetamide |
| PubChem CID | 2903852 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | N-(5-methyl-4-oxo-1,3-thiazol-2-yl)-2-phenoxyacetamide |
| SMILES | CC1SC(NC(=O)COc2ccccc2)=NC1=O |
| InChI | InChI=1S/C12H12N2O3S/c1-8-11(16)14-12(18-8)13-10(15)7-17-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,13,14,15,16) |
| InChIKey | WHUJJIXJIJPSLT-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(5-methyl-4-oxo-1,3-thiazol-2-yl)-2-phenoxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-methyl-4-oxo-1,3-thiazol-2-yl)-2-phenoxyacetamide?
The IUPAC name of N-(5-methyl-4-oxo-1,3-thiazol-2-yl)-2-phenoxyacetamide (CID 2903852) is N-(5-methyl-4-oxo-1,3-thiazol-2-yl)-2-phenoxyacetamide.
What is the SMILES notation for N-(5-methyl-4-oxo-1,3-thiazol-2-yl)-2-phenoxyacetamide?
The canonical SMILES for N-(5-methyl-4-oxo-1,3-thiazol-2-yl)-2-phenoxyacetamide is CC1SC(NC(=O)COc2ccccc2)=NC1=O.
What is the InChIKey of N-(5-methyl-4-oxo-1,3-thiazol-2-yl)-2-phenoxyacetamide?
The InChIKey is WHUJJIXJIJPSLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O3S/c1-8-11(16)14-12(18-8)13-10(15)7-17-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,13,14,15,16).
What are the key properties of N-(5-methyl-4-oxo-1,3-thiazol-2-yl)-2-phenoxyacetamide?
N-(5-methyl-4-oxo-1,3-thiazol-2-yl)-2-phenoxyacetamide has a molecular weight of 264.31 g/mol, XLogP of 1.20, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-methyl-4-oxo-1,3-thiazol-2-yl)-2-phenoxyacetamide is sourced from PubChem (CID 2903852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).