C11H17N3S — CID 29039739
[(1R,7S)-7,10,10-trimethyl-3-thia-5-azatricyclo[5.2.1.02,6]deca-2(6),4-dien-4-yl]hydrazine (PubChem CID 29039739) has the molecular formula C11H17N3S and a molecular weight of 223.34 g/mol. Its IUPAC name is [(1R,7S)-7,10,10-trimethyl-3-thia-5-azatricyclo[5.2.1.02,6]deca-2(6),4-dien-4-yl]hydrazine.
| Compound Name | [(1R,7S)-7,10,10-trimethyl-3-thia-5-azatricyclo[5.2.1.02,6]deca-2(6),4-dien-4-yl]hydrazine |
|---|---|
| PubChem CID | 29039739 |
| Molecular Formula | C11H17N3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | [(1R,7S)-7,10,10-trimethyl-3-thia-5-azatricyclo[5.2.1.02,6]deca-2(6),4-dien-4-yl]hydrazine |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)c1nc(NN)sc12 |
| InChI | InChI=1S/C11H17N3S/c1-10(2)6-4-5-11(10,3)8-7(6)15-9(13-8)14-12/h6H,4-5,12H2,1-3H3,(H,13,14)/t6-,11+/m0/s1 |
| InChIKey | NJBLDAVBXVRRRS-UPONEAKYSA-N |
| XLogP | 2.60 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|