C14H11ClN4O3 — CID 2904035
7-chloro-N-(2,3-dimethylphenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine (PubChem CID 2904035) has the molecular formula C14H11ClN4O3 and a molecular weight of 318.72 g/mol. Its IUPAC name is 7-chloro-N-(2,3-dimethylphenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine.
| Compound Name | 7-chloro-N-(2,3-dimethylphenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine |
|---|---|
| PubChem CID | 2904035 |
| Molecular Formula | C14H11ClN4O3 |
| Molecular Weight | 318.72 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 7-chloro-N-(2,3-dimethylphenyl)-4-nitro-2,1,3-benzoxadiazol-5-amine |
| SMILES | Cc1cccc(Nc2cc(Cl)c3nonc3c2[N+](=O)[O-])c1C |
| InChI | InChI=1S/C14H11ClN4O3/c1-7-4-3-5-10(8(7)2)16-11-6-9(15)12-13(18-22-17-12)14(11)19(20)21/h3-6,16H,1-2H3 |
| InChIKey | VGUSSVCIGNSVRI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.72 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|