About N-[(2-methyl-4-nitrophenyl)carbamothioyl]-2,2-diphenylacetamide
N-[(2-methyl-4-nitrophenyl)carbamothioyl]-2,2-diphenylacetamide (PubChem CID 2904107) has the molecular formula C22H19N3O3S
and a molecular weight of 405.48 g/mol. Its IUPAC name is N-[(2-methyl-4-nitrophenyl)carbamothioyl]-2,2-diphenylacetamide.
Molecular Properties
| Compound Name | N-[(2-methyl-4-nitrophenyl)carbamothioyl]-2,2-diphenylacetamide |
| PubChem CID | 2904107 |
| Molecular Formula | C22H19N3O3S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | N-[(2-methyl-4-nitrophenyl)carbamothioyl]-2,2-diphenylacetamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=S)NC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H19N3O3S/c1-15-14-18(25(27)28)12-13-19(15)23-22(29)24-21(26)20(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-14,20H,1H3,(H2,23,24,26,29) |
| InChIKey | MCNFUIAAIRZXOT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[(2-methyl-4-nitrophenyl)carbamothioyl]-2,2-diphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-methyl-4-nitrophenyl)carbamothioyl]-2,2-diphenylacetamide?
The IUPAC name of N-[(2-methyl-4-nitrophenyl)carbamothioyl]-2,2-diphenylacetamide (CID 2904107) is N-[(2-methyl-4-nitrophenyl)carbamothioyl]-2,2-diphenylacetamide.
What is the SMILES notation for N-[(2-methyl-4-nitrophenyl)carbamothioyl]-2,2-diphenylacetamide?
The canonical SMILES for N-[(2-methyl-4-nitrophenyl)carbamothioyl]-2,2-diphenylacetamide is Cc1cc([N+](=O)[O-])ccc1NC(=S)NC(=O)C(c1ccccc1)c1ccccc1.
What is the InChIKey of N-[(2-methyl-4-nitrophenyl)carbamothioyl]-2,2-diphenylacetamide?
The InChIKey is MCNFUIAAIRZXOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N3O3S/c1-15-14-18(25(27)28)12-13-19(15)23-22(29)24-21(26)20(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-14,20H,1H3,(H2,23,24,26,29).
What are the key properties of N-[(2-methyl-4-nitrophenyl)carbamothioyl]-2,2-diphenylacetamide?
N-[(2-methyl-4-nitrophenyl)carbamothioyl]-2,2-diphenylacetamide has a molecular weight of 405.48 g/mol, XLogP of 4.55, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-methyl-4-nitrophenyl)carbamothioyl]-2,2-diphenylacetamide is sourced from PubChem (CID 2904107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).