About 2,6-difluoro-3-(1,3-thiazol-2-ylsulfamoyl)benzoic acid
2,6-difluoro-3-(1,3-thiazol-2-ylsulfamoyl)benzoic acid (PubChem CID 29041516) has the molecular formula C10H6F2N2O4S2
and a molecular weight of 320.30 g/mol. Its IUPAC name is 2,6-difluoro-3-(1,3-thiazol-2-ylsulfamoyl)benzoic acid.
Molecular Properties
| Compound Name | 2,6-difluoro-3-(1,3-thiazol-2-ylsulfamoyl)benzoic acid |
| PubChem CID | 29041516 |
| Molecular Formula | C10H6F2N2O4S2 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 319.97 |
| IUPAC Name | 2,6-difluoro-3-(1,3-thiazol-2-ylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1c(F)ccc(S(=O)(=O)Nc2nccs2)c1F |
| InChI | InChI=1S/C10H6F2N2O4S2/c11-5-1-2-6(8(12)7(5)9(15)16)20(17,18)14-10-13-3-4-19-10/h1-4H,(H,13,14)(H,15,16) |
| InChIKey | VFHDHDSSTRHALY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,6-difluoro-3-(1,3-thiazol-2-ylsulfamoyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-difluoro-3-(1,3-thiazol-2-ylsulfamoyl)benzoic acid?
The IUPAC name of 2,6-difluoro-3-(1,3-thiazol-2-ylsulfamoyl)benzoic acid (CID 29041516) is 2,6-difluoro-3-(1,3-thiazol-2-ylsulfamoyl)benzoic acid.
What is the SMILES notation for 2,6-difluoro-3-(1,3-thiazol-2-ylsulfamoyl)benzoic acid?
The canonical SMILES for 2,6-difluoro-3-(1,3-thiazol-2-ylsulfamoyl)benzoic acid is O=C(O)c1c(F)ccc(S(=O)(=O)Nc2nccs2)c1F.
What is the InChIKey of 2,6-difluoro-3-(1,3-thiazol-2-ylsulfamoyl)benzoic acid?
The InChIKey is VFHDHDSSTRHALY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6F2N2O4S2/c11-5-1-2-6(8(12)7(5)9(15)16)20(17,18)14-10-13-3-4-19-10/h1-4H,(H,13,14)(H,15,16).
What are the key properties of 2,6-difluoro-3-(1,3-thiazol-2-ylsulfamoyl)benzoic acid?
2,6-difluoro-3-(1,3-thiazol-2-ylsulfamoyl)benzoic acid has a molecular weight of 320.30 g/mol, XLogP of 1.92, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-difluoro-3-(1,3-thiazol-2-ylsulfamoyl)benzoic acid is sourced from PubChem (CID 29041516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).