About 2-hydroxy-4-methyl-5-(2,2,2-trifluoroethylsulfamoyl)benzoic acid
2-hydroxy-4-methyl-5-(2,2,2-trifluoroethylsulfamoyl)benzoic acid (PubChem CID 29042656) has the molecular formula C10H10F3NO5S
and a molecular weight of 313.25 g/mol. Its IUPAC name is 2-hydroxy-4-methyl-5-(2,2,2-trifluoroethylsulfamoyl)benzoic acid.
Molecular Properties
| Compound Name | 2-hydroxy-4-methyl-5-(2,2,2-trifluoroethylsulfamoyl)benzoic acid |
| PubChem CID | 29042656 |
| Molecular Formula | C10H10F3NO5S |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 2-hydroxy-4-methyl-5-(2,2,2-trifluoroethylsulfamoyl)benzoic acid |
| SMILES | Cc1cc(O)c(C(=O)O)cc1S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C10H10F3NO5S/c1-5-2-7(15)6(9(16)17)3-8(5)20(18,19)14-4-10(11,12)13/h2-3,14-15H,4H2,1H3,(H,16,17) |
| InChIKey | UFIOUSDLWFSCFK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxy-4-methyl-5-(2,2,2-trifluoroethylsulfamoyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-4-methyl-5-(2,2,2-trifluoroethylsulfamoyl)benzoic acid?
The IUPAC name of 2-hydroxy-4-methyl-5-(2,2,2-trifluoroethylsulfamoyl)benzoic acid (CID 29042656) is 2-hydroxy-4-methyl-5-(2,2,2-trifluoroethylsulfamoyl)benzoic acid.
What is the SMILES notation for 2-hydroxy-4-methyl-5-(2,2,2-trifluoroethylsulfamoyl)benzoic acid?
The canonical SMILES for 2-hydroxy-4-methyl-5-(2,2,2-trifluoroethylsulfamoyl)benzoic acid is Cc1cc(O)c(C(=O)O)cc1S(=O)(=O)NCC(F)(F)F.
What is the InChIKey of 2-hydroxy-4-methyl-5-(2,2,2-trifluoroethylsulfamoyl)benzoic acid?
The InChIKey is UFIOUSDLWFSCFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F3NO5S/c1-5-2-7(15)6(9(16)17)3-8(5)20(18,19)14-4-10(11,12)13/h2-3,14-15H,4H2,1H3,(H,16,17).
What are the key properties of 2-hydroxy-4-methyl-5-(2,2,2-trifluoroethylsulfamoyl)benzoic acid?
2-hydroxy-4-methyl-5-(2,2,2-trifluoroethylsulfamoyl)benzoic acid has a molecular weight of 313.25 g/mol, XLogP of 1.24, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-4-methyl-5-(2,2,2-trifluoroethylsulfamoyl)benzoic acid is sourced from PubChem (CID 29042656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).