C17H15NO2 — CID 29048417
3-(2,5-dimethylpyrrol-1-yl)naphthalene-2-carboxylic acid (PubChem CID 29048417) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is 3-(2,5-dimethylpyrrol-1-yl)naphthalene-2-carboxylic acid.
| Compound Name | 3-(2,5-dimethylpyrrol-1-yl)naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 29048417 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 3-(2,5-dimethylpyrrol-1-yl)naphthalene-2-carboxylic acid |
| SMILES | Cc1ccc(C)n1-c1cc2ccccc2cc1C(=O)O |
| InChI | InChI=1S/C17H15NO2/c1-11-7-8-12(2)18(11)16-10-14-6-4-3-5-13(14)9-15(16)17(19)20/h3-10H,1-2H3,(H,19,20) |
| InChIKey | BQLSAWNNPBBTGC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|