C23H25ClN2O7 — CID 29048890
6-O-methyl 3-O-propyl (4S,6S,7S)-4-(4-chloro-3-nitrophenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 29048890) has the molecular formula C23H25ClN2O7 and a molecular weight of 476.91 g/mol. Its IUPAC name is 6-O-methyl 3-O-propyl (4S,6S,7S)-4-(4-chloro-3-nitrophenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | 6-O-methyl 3-O-propyl (4S,6S,7S)-4-(4-chloro-3-nitrophenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 29048890 |
| Molecular Formula | C23H25ClN2O7 |
| Molecular Weight | 476.91 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 6-O-methyl 3-O-propyl (4S,6S,7S)-4-(4-chloro-3-nitrophenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | CCCOC(=O)C1=C(C)NC2=C(C(=O)[C@@H](C(=O)OC)[C@@H](C)C2)[C@@H]1c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H25ClN2O7/c1-5-8-33-23(29)18-12(3)25-15-9-11(2)17(22(28)32-4)21(27)20(15)19(18)13-6-7-14(24)16(10-13)26(30)31/h6-7,10-11,17,19,25H,5,8-9H2,1-4H3/t11-,17-,19+/m0/s1 |
| InChIKey | QELDAYDXUHGIPF-WOVYWWTOSA-N |
| XLogP | 3.81 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.91 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|