C10H11BrF3N — CID 29048990
4-bromo-2,6-dimethyl-N-(2,2,2-trifluoroethyl)aniline (PubChem CID 29048990) has the molecular formula C10H11BrF3N and a molecular weight of 282.10 g/mol. Its IUPAC name is 4-bromo-2,6-dimethyl-N-(2,2,2-trifluoroethyl)aniline.
| Compound Name | 4-bromo-2,6-dimethyl-N-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 29048990 |
| Molecular Formula | C10H11BrF3N |
| Molecular Weight | 282.10 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | 4-bromo-2,6-dimethyl-N-(2,2,2-trifluoroethyl)aniline |
| SMILES | Cc1cc(Br)cc(C)c1NCC(F)(F)F |
| InChI | InChI=1S/C10H11BrF3N/c1-6-3-8(11)4-7(2)9(6)15-5-10(12,13)14/h3-4,15H,5H2,1-2H3 |
| InChIKey | PAHCLSSSWXKCGN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.10 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |