C14H22ClNO2 — CID 2904909
2-(4-methoxyphenyl)-N-(oxolan-2-ylmethyl)ethanamine;hydrochloride (PubChem CID 2904909) has the molecular formula C14H22ClNO2 and a molecular weight of 271.79 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-(oxolan-2-ylmethyl)ethanamine;hydrochloride.
| Compound Name | 2-(4-methoxyphenyl)-N-(oxolan-2-ylmethyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 2904909 |
| Molecular Formula | C14H22ClNO2 |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-(oxolan-2-ylmethyl)ethanamine;hydrochloride |
| SMILES | COc1ccc(CCNCC2CCCO2)cc1.Cl |
| InChI | InChI=1S/C14H21NO2.ClH/c1-16-13-6-4-12(5-7-13)8-9-15-11-14-3-2-10-17-14;/h4-7,14-15H,2-3,8-11H2,1H3;1H |
| InChIKey | AELUJRMLOQTIPA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|