About 4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]benzamide
4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]benzamide (PubChem CID 2904911) has the molecular formula C13H9N5O4
and a molecular weight of 299.25 g/mol. Its IUPAC name is 4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]benzamide.
Molecular Properties
| Compound Name | 4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]benzamide |
| PubChem CID | 2904911 |
| Molecular Formula | C13H9N5O4 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]benzamide |
| SMILES | NC(=O)c1ccc(Nc2ccc3nonc3c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H9N5O4/c14-13(19)7-1-3-8(4-2-7)15-10-6-5-9-11(17-22-16-9)12(10)18(20)21/h1-6,15H,(H2,14,19) |
| InChIKey | OKNORMALFRSNRP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 137.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]benzamide?
The IUPAC name of 4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]benzamide (CID 2904911) is 4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]benzamide.
What is the SMILES notation for 4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]benzamide?
The canonical SMILES for 4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]benzamide is NC(=O)c1ccc(Nc2ccc3nonc3c2[N+](=O)[O-])cc1.
What is the InChIKey of 4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]benzamide?
The InChIKey is OKNORMALFRSNRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N5O4/c14-13(19)7-1-3-8(4-2-7)15-10-6-5-9-11(17-22-16-9)12(10)18(20)21/h1-6,15H,(H2,14,19).
What are the key properties of 4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]benzamide?
4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]benzamide has a molecular weight of 299.25 g/mol, XLogP of 1.97, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]benzamide is sourced from PubChem (CID 2904911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).