C26H33NO7 — CID 29049173
6-O-methyl 3-O-(2-propoxyethyl) (4S,6S,7S)-4-(3-methoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 29049173) has the molecular formula C26H33NO7 and a molecular weight of 471.55 g/mol. Its IUPAC name is 6-O-methyl 3-O-(2-propoxyethyl) (4S,6S,7S)-4-(3-methoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | 6-O-methyl 3-O-(2-propoxyethyl) (4S,6S,7S)-4-(3-methoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 29049173 |
| Molecular Formula | C26H33NO7 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 6-O-methyl 3-O-(2-propoxyethyl) (4S,6S,7S)-4-(3-methoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | CCCOCCOC(=O)C1=C(C)NC2=C(C(=O)[C@@H](C(=O)OC)[C@@H](C)C2)[C@@H]1c1cccc(OC)c1 |
| InChI | InChI=1S/C26H33NO7/c1-6-10-33-11-12-34-26(30)21-16(3)27-19-13-15(2)20(25(29)32-5)24(28)23(19)22(21)17-8-7-9-18(14-17)31-4/h7-9,14-15,20,22,27H,6,10-13H2,1-5H3/t15-,20-,22+/m0/s1 |
| InChIKey | CKSSBJZTFUVEOX-GJULWVSJSA-N |
| XLogP | 3.28 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|