C17H19N3O7 — CID 2904926
1,3-dimethyl-5-nitro-6-[2-(2,3,4-trimethoxyphenyl)ethenyl]pyrimidine-2,4-dione (PubChem CID 2904926) has the molecular formula C17H19N3O7 and a molecular weight of 377.35 g/mol. Its IUPAC name is 1,3-dimethyl-5-nitro-6-[2-(2,3,4-trimethoxyphenyl)ethenyl]pyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-5-nitro-6-[2-(2,3,4-trimethoxyphenyl)ethenyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2904926 |
| Molecular Formula | C17H19N3O7 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 1,3-dimethyl-5-nitro-6-[2-(2,3,4-trimethoxyphenyl)ethenyl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(C=Cc2c([N+](=O)[O-])c(=O)n(C)c(=O)n2C)c(OC)c1OC |
| InChI | InChI=1S/C17H19N3O7/c1-18-11(13(20(23)24)16(21)19(2)17(18)22)8-6-10-7-9-12(25-3)15(27-5)14(10)26-4/h6-9H,1-5H3 |
| InChIKey | QBCYTXJGIYVNER-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 114.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|