C14H11Br2ClN2O2 — CID 29050775
N-(2-amino-5-chlorophenyl)-2-(2,6-dibromophenoxy)acetamide (PubChem CID 29050775) has the molecular formula C14H11Br2ClN2O2 and a molecular weight of 434.52 g/mol. Its IUPAC name is N-(2-amino-5-chlorophenyl)-2-(2,6-dibromophenoxy)acetamide.
| Compound Name | N-(2-amino-5-chlorophenyl)-2-(2,6-dibromophenoxy)acetamide |
|---|---|
| PubChem CID | 29050775 |
| Molecular Formula | C14H11Br2ClN2O2 |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 431.89 |
| IUPAC Name | N-(2-amino-5-chlorophenyl)-2-(2,6-dibromophenoxy)acetamide |
| SMILES | Nc1ccc(Cl)cc1NC(=O)COc1c(Br)cccc1Br |
| InChI | InChI=1S/C14H11Br2ClN2O2/c15-9-2-1-3-10(16)14(9)21-7-13(20)19-12-6-8(17)4-5-11(12)18/h1-6H,7,18H2,(H,19,20) |
| InChIKey | GPMJTZVKRIVSIT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|