About 6-methoxy-2H-chromene
6-methoxy-2H-chromene (PubChem CID 29052) has the molecular formula C10H10O2
and a molecular weight of 162.19 g/mol. Its IUPAC name is 6-methoxy-2H-chromene.
Molecular Properties
| Compound Name | 6-methoxy-2H-chromene |
| PubChem CID | 29052 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 6-methoxy-2H-chromene |
| SMILES | COc1ccc2c(c1)C=CCO2 |
| InChI | InChI=1S/C10H10O2/c1-11-9-4-5-10-8(7-9)3-2-6-12-10/h2-5,7H,6H2,1H3 |
| InChIKey | LMCDFCKWRNBXBB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methoxy-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-2H-chromene?
The IUPAC name of 6-methoxy-2H-chromene (CID 29052) is 6-methoxy-2H-chromene.
What is the SMILES notation for 6-methoxy-2H-chromene?
The canonical SMILES for 6-methoxy-2H-chromene is COc1ccc2c(c1)C=CCO2.
What is the InChIKey of 6-methoxy-2H-chromene?
The InChIKey is LMCDFCKWRNBXBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2/c1-11-9-4-5-10-8(7-9)3-2-6-12-10/h2-5,7H,6H2,1H3.
What are the key properties of 6-methoxy-2H-chromene?
6-methoxy-2H-chromene has a molecular weight of 162.19 g/mol, XLogP of 2.10, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-2H-chromene is sourced from PubChem (CID 29052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).