C11H11N3O2S3 — CID 29052014
4-[(5-methyl-1,3-thiazol-2-yl)sulfamoyl]benzenecarbothioamide (PubChem CID 29052014) has the molecular formula C11H11N3O2S3 and a molecular weight of 313.43 g/mol. Its IUPAC name is 4-[(5-methyl-1,3-thiazol-2-yl)sulfamoyl]benzenecarbothioamide.
| Compound Name | 4-[(5-methyl-1,3-thiazol-2-yl)sulfamoyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 29052014 |
| Molecular Formula | C11H11N3O2S3 |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | 4-[(5-methyl-1,3-thiazol-2-yl)sulfamoyl]benzenecarbothioamide |
| SMILES | Cc1cnc(NS(=O)(=O)c2ccc(C(N)=S)cc2)s1 |
| InChI | InChI=1S/C11H11N3O2S3/c1-7-6-13-11(18-7)14-19(15,16)9-4-2-8(3-5-9)10(12)17/h2-6H,1H3,(H2,12,17)(H,13,14) |
| InChIKey | YFLBCHGRBPSWRN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|