C16H15ClN2S — CID 29054834
(1S)-N-(1,3-benzothiazol-2-ylmethyl)-1-(2-chlorophenyl)ethanamine (PubChem CID 29054834) has the molecular formula C16H15ClN2S and a molecular weight of 302.83 g/mol. Its IUPAC name is (1S)-N-(1,3-benzothiazol-2-ylmethyl)-1-(2-chlorophenyl)ethanamine.
| Compound Name | (1S)-N-(1,3-benzothiazol-2-ylmethyl)-1-(2-chlorophenyl)ethanamine |
|---|---|
| PubChem CID | 29054834 |
| Molecular Formula | C16H15ClN2S |
| Molecular Weight | 302.83 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | (1S)-N-(1,3-benzothiazol-2-ylmethyl)-1-(2-chlorophenyl)ethanamine |
| SMILES | C[C@H](NCc1nc2ccccc2s1)c1ccccc1Cl |
| InChI | InChI=1S/C16H15ClN2S/c1-11(12-6-2-3-7-13(12)17)18-10-16-19-14-8-4-5-9-15(14)20-16/h2-9,11,18H,10H2,1H3/t11-/m0/s1 |
| InChIKey | RCRHJXCDQPWSDT-NSHDSACASA-N |
| XLogP | 4.80 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.83 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |