C20H19N3O3 — CID 29055361
(3R)-2'-amino-1,6,6-trimethylspiro[5,7-dihydroindole-3,4'-indeno[2,1-d][1,3]oxazole]-2,4-dione (PubChem CID 29055361) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is (3R)-2'-amino-1,6,6-trimethylspiro[5,7-dihydroindole-3,4'-indeno[2,1-d][1,3]oxazole]-2,4-dione.
| Compound Name | (3R)-2'-amino-1,6,6-trimethylspiro[5,7-dihydroindole-3,4'-indeno[2,1-d][1,3]oxazole]-2,4-dione |
|---|---|
| PubChem CID | 29055361 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | (3R)-2'-amino-1,6,6-trimethylspiro[5,7-dihydroindole-3,4'-indeno[2,1-d][1,3]oxazole]-2,4-dione |
| SMILES | CN1C(=O)[C@@]2(C3=C1CC(C)(C)CC3=O)c1ccccc1-c1oc(N)nc12 |
| InChI | InChI=1S/C20H19N3O3/c1-19(2)8-12-14(13(24)9-19)20(17(25)23(12)3)11-7-5-4-6-10(11)15-16(20)22-18(21)26-15/h4-7H,8-9H2,1-3H3,(H2,21,22)/t20-/m1/s1 |
| InChIKey | CBRKEUHDOVXNTR-HXUWFJFHSA-N |
| XLogP | 2.64 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |