C10H14N4O4 — CID 29056266
(7R,8S,8aS)-7-amino-7,8-dimethyl-3,6-dioxido-5,8-dihydro-4H-pyrrolo[2,3-g][2,1,3]benzoxadiazole-3,6-diium-8a-ol (PubChem CID 29056266) has the molecular formula C10H14N4O4 and a molecular weight of 254.25 g/mol. Its IUPAC name is (7R,8S,8aS)-7-amino-7,8-dimethyl-3,6-dioxido-5,8-dihydro-4H-pyrrolo[2,3-g][2,1,3]benzoxadiazole-3,6-diium-8a-ol.
| Compound Name | (7R,8S,8aS)-7-amino-7,8-dimethyl-3,6-dioxido-5,8-dihydro-4H-pyrrolo[2,3-g][2,1,3]benzoxadiazole-3,6-diium-8a-ol |
|---|---|
| PubChem CID | 29056266 |
| Molecular Formula | C10H14N4O4 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | (7R,8S,8aS)-7-amino-7,8-dimethyl-3,6-dioxido-5,8-dihydro-4H-pyrrolo[2,3-g][2,1,3]benzoxadiazole-3,6-diium-8a-ol |
| SMILES | C[C@@H]1[C@@]2(O)C(=[N+]([O-])[C@@]1(C)N)CCc1c2no[n+]1[O-] |
| InChI | InChI=1S/C10H14N4O4/c1-5-9(2,11)13(16)7-4-3-6-8(10(5,7)15)12-18-14(6)17/h5,15H,3-4,11H2,1-2H3/t5-,9+,10+/m0/s1 |
| InChIKey | QLUCCJIGPHMXHF-MPWNKIQUSA-N |
| XLogP | -1.28 |
| TPSA | 125.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|