About N-(1-ethyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-yl)acetamide
N-(1-ethyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-yl)acetamide (PubChem CID 2905709) has the molecular formula C13H23N3O
and a molecular weight of 237.35 g/mol. Its IUPAC name is N-(1-ethyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-yl)acetamide.
Molecular Properties
| Compound Name | N-(1-ethyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-yl)acetamide |
| PubChem CID | 2905709 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | N-(1-ethyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-yl)acetamide |
| SMILES | CCC12CN3CCN(CC(C3)C1NC(C)=O)C2 |
| InChI | InChI=1S/C13H23N3O/c1-3-13-8-15-4-5-16(9-13)7-11(6-15)12(13)14-10(2)17/h11-12H,3-9H2,1-2H3,(H,14,17) |
| InChIKey | GMODPUWRQHKYPH-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1-ethyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-ethyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-yl)acetamide?
The IUPAC name of N-(1-ethyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-yl)acetamide (CID 2905709) is N-(1-ethyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-yl)acetamide.
What is the SMILES notation for N-(1-ethyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-yl)acetamide?
The canonical SMILES for N-(1-ethyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-yl)acetamide is CCC12CN3CCN(CC(C3)C1NC(C)=O)C2.
What is the InChIKey of N-(1-ethyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-yl)acetamide?
The InChIKey is GMODPUWRQHKYPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O/c1-3-13-8-15-4-5-16(9-13)7-11(6-15)12(13)14-10(2)17/h11-12H,3-9H2,1-2H3,(H,14,17).
What are the key properties of N-(1-ethyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-yl)acetamide?
N-(1-ethyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-yl)acetamide has a molecular weight of 237.35 g/mol, XLogP of 0.15, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-ethyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-yl)acetamide is sourced from PubChem (CID 2905709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).