About CID 29057123
CID 29057123 (PubChem CID 29057123) has the molecular formula C22H20ClN3O3S2
and a molecular weight of 474.01 g/mol.
Molecular Properties
| Compound Name | CID 29057123 |
| PubChem CID | 29057123 |
| Molecular Formula | C22H20ClN3O3S2 |
| Molecular Weight | 474.01 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | — |
| SMILES | C=CCN1C(=O)[C@@]2(SC1=S)[C@@H](c1ccco1)CN(C)[C@]21C(=O)N(C)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C22H20ClN3O3S2/c1-4-9-26-19(28)22(31-20(26)30)15(17-6-5-10-29-17)12-24(2)21(22)14-11-13(23)7-8-16(14)25(3)18(21)27/h4-8,10-11,15H,1,9,12H2,2-3H3/t15-,21-,22+/m1/s1 |
| InChIKey | ABRCIZNUNFFRMD-RTOPAQNCSA-N |
| XLogP | 3.62 |
| TPSA | 57.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.01 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze CID 29057123 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 29057123?
The IUPAC name of CID 29057123 (CID 29057123) is not available.
What is the SMILES notation for CID 29057123?
The canonical SMILES for CID 29057123 is C=CCN1C(=O)[C@@]2(SC1=S)[C@@H](c1ccco1)CN(C)[C@]21C(=O)N(C)c2ccc(Cl)cc21.
What is the InChIKey of CID 29057123?
The InChIKey is ABRCIZNUNFFRMD-RTOPAQNCSA-N. The full InChI is InChI=1S/C22H20ClN3O3S2/c1-4-9-26-19(28)22(31-20(26)30)15(17-6-5-10-29-17)12-24(2)21(22)14-11-13(23)7-8-16(14)25(3)18(21)27/h4-8,10-11,15H,1,9,12H2,2-3H3/t15-,21-,22+/m1/s1.
What are the key properties of CID 29057123?
CID 29057123 has a molecular weight of 474.01 g/mol, XLogP of 3.62, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 29057123 is sourced from PubChem (CID 29057123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).