About N-butyl-N-(1,1-dioxothiolan-3-yl)benzenesulfonamide
N-butyl-N-(1,1-dioxothiolan-3-yl)benzenesulfonamide (PubChem CID 2905982) has the molecular formula C14H21NO4S2
and a molecular weight of 331.46 g/mol. Its IUPAC name is N-butyl-N-(1,1-dioxothiolan-3-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-butyl-N-(1,1-dioxothiolan-3-yl)benzenesulfonamide |
| PubChem CID | 2905982 |
| Molecular Formula | C14H21NO4S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | N-butyl-N-(1,1-dioxothiolan-3-yl)benzenesulfonamide |
| SMILES | CCCCN(C1CCS(=O)(=O)C1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H21NO4S2/c1-2-3-10-15(13-9-11-20(16,17)12-13)21(18,19)14-7-5-4-6-8-14/h4-8,13H,2-3,9-12H2,1H3 |
| InChIKey | YOMVEJNJCQURHL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-butyl-N-(1,1-dioxothiolan-3-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-(1,1-dioxothiolan-3-yl)benzenesulfonamide?
The IUPAC name of N-butyl-N-(1,1-dioxothiolan-3-yl)benzenesulfonamide (CID 2905982) is N-butyl-N-(1,1-dioxothiolan-3-yl)benzenesulfonamide.
What is the SMILES notation for N-butyl-N-(1,1-dioxothiolan-3-yl)benzenesulfonamide?
The canonical SMILES for N-butyl-N-(1,1-dioxothiolan-3-yl)benzenesulfonamide is CCCCN(C1CCS(=O)(=O)C1)S(=O)(=O)c1ccccc1.
What is the InChIKey of N-butyl-N-(1,1-dioxothiolan-3-yl)benzenesulfonamide?
The InChIKey is YOMVEJNJCQURHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO4S2/c1-2-3-10-15(13-9-11-20(16,17)12-13)21(18,19)14-7-5-4-6-8-14/h4-8,13H,2-3,9-12H2,1H3.
What are the key properties of N-butyl-N-(1,1-dioxothiolan-3-yl)benzenesulfonamide?
N-butyl-N-(1,1-dioxothiolan-3-yl)benzenesulfonamide has a molecular weight of 331.46 g/mol, XLogP of 1.66, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-(1,1-dioxothiolan-3-yl)benzenesulfonamide is sourced from PubChem (CID 2905982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).