C10H13NO4S2 — CID 2906106
N-(1,1-dioxothiolan-3-yl)benzenesulfonamide (PubChem CID 2906106) has the molecular formula C10H13NO4S2 and a molecular weight of 275.35 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)benzenesulfonamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 2906106 |
| Molecular Formula | C10H13NO4S2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)benzenesulfonamide |
| SMILES | O=S1(=O)CCC(NS(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C10H13NO4S2/c12-16(13)7-6-9(8-16)11-17(14,15)10-4-2-1-3-5-10/h1-5,9,11H,6-8H2 |
| InChIKey | XTMOTIGEBLVQPG-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |