C12H18N2O2 — CID 29061664
(2S)-2-(aminomethyl)-3-(4-ethoxyphenyl)propanamide (PubChem CID 29061664) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is (2S)-2-(aminomethyl)-3-(4-ethoxyphenyl)propanamide.
| Compound Name | (2S)-2-(aminomethyl)-3-(4-ethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 29061664 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | (2S)-2-(aminomethyl)-3-(4-ethoxyphenyl)propanamide |
| SMILES | CCOc1ccc(C[C@@H](CN)C(N)=O)cc1 |
| InChI | InChI=1S/C12H18N2O2/c1-2-16-11-5-3-9(4-6-11)7-10(8-13)12(14)15/h3-6,10H,2,7-8,13H2,1H3,(H2,14,15)/t10-/m0/s1 |
| InChIKey | FWLAZESHVLTOAN-JTQLQIEISA-N |
| XLogP | 0.69 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |