About 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-pyridin-2-ylthiourea
1-(3-methyl-1,1-dioxothiolan-3-yl)-3-pyridin-2-ylthiourea (PubChem CID 2906253) has the molecular formula C11H15N3O2S2
and a molecular weight of 285.39 g/mol. Its IUPAC name is 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-pyridin-2-ylthiourea.
Molecular Properties
| Compound Name | 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-pyridin-2-ylthiourea |
| PubChem CID | 2906253 |
| Molecular Formula | C11H15N3O2S2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-pyridin-2-ylthiourea |
| SMILES | CC1(NC(=S)Nc2ccccn2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H15N3O2S2/c1-11(5-7-18(15,16)8-11)14-10(17)13-9-4-2-3-6-12-9/h2-4,6H,5,7-8H2,1H3,(H2,12,13,14,17) |
| InChIKey | BPQFXSSMIBGPQJ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-pyridin-2-ylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-pyridin-2-ylthiourea?
The IUPAC name of 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-pyridin-2-ylthiourea (CID 2906253) is 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-pyridin-2-ylthiourea.
What is the SMILES notation for 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-pyridin-2-ylthiourea?
The canonical SMILES for 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-pyridin-2-ylthiourea is CC1(NC(=S)Nc2ccccn2)CCS(=O)(=O)C1.
What is the InChIKey of 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-pyridin-2-ylthiourea?
The InChIKey is BPQFXSSMIBGPQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O2S2/c1-11(5-7-18(15,16)8-11)14-10(17)13-9-4-2-3-6-12-9/h2-4,6H,5,7-8H2,1H3,(H2,12,13,14,17).
What are the key properties of 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-pyridin-2-ylthiourea?
1-(3-methyl-1,1-dioxothiolan-3-yl)-3-pyridin-2-ylthiourea has a molecular weight of 285.39 g/mol, XLogP of 0.95, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methyl-1,1-dioxothiolan-3-yl)-3-pyridin-2-ylthiourea is sourced from PubChem (CID 2906253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).