About 5-(2-phenylanilino)-3H-1,3,4-thiadiazole-2-thione
5-(2-phenylanilino)-3H-1,3,4-thiadiazole-2-thione (PubChem CID 29062965) has the molecular formula C14H11N3S2
and a molecular weight of 285.40 g/mol. Its IUPAC name is 5-(2-phenylanilino)-3H-1,3,4-thiadiazole-2-thione.
Molecular Properties
| Compound Name | 5-(2-phenylanilino)-3H-1,3,4-thiadiazole-2-thione |
| PubChem CID | 29062965 |
| Molecular Formula | C14H11N3S2 |
| Molecular Weight | 285.40 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 5-(2-phenylanilino)-3H-1,3,4-thiadiazole-2-thione |
| SMILES | S=c1[nH]nc(Nc2ccccc2-c2ccccc2)s1 |
| InChI | InChI=1S/C14H11N3S2/c18-14-17-16-13(19-14)15-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H,(H,15,16)(H,17,18) |
| InChIKey | JTZPIKWATKBLSM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-phenylanilino)-3H-1,3,4-thiadiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-phenylanilino)-3H-1,3,4-thiadiazole-2-thione?
The IUPAC name of 5-(2-phenylanilino)-3H-1,3,4-thiadiazole-2-thione (CID 29062965) is 5-(2-phenylanilino)-3H-1,3,4-thiadiazole-2-thione.
What is the SMILES notation for 5-(2-phenylanilino)-3H-1,3,4-thiadiazole-2-thione?
The canonical SMILES for 5-(2-phenylanilino)-3H-1,3,4-thiadiazole-2-thione is S=c1[nH]nc(Nc2ccccc2-c2ccccc2)s1.
What is the InChIKey of 5-(2-phenylanilino)-3H-1,3,4-thiadiazole-2-thione?
The InChIKey is JTZPIKWATKBLSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3S2/c18-14-17-16-13(19-14)15-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H,(H,15,16)(H,17,18).
What are the key properties of 5-(2-phenylanilino)-3H-1,3,4-thiadiazole-2-thione?
5-(2-phenylanilino)-3H-1,3,4-thiadiazole-2-thione has a molecular weight of 285.40 g/mol, XLogP of 4.61, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-phenylanilino)-3H-1,3,4-thiadiazole-2-thione is sourced from PubChem (CID 29062965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).