About 4-cyclopentyl-1H-1,2,4-triazole-5-thione
4-cyclopentyl-1H-1,2,4-triazole-5-thione (PubChem CID 29064874) has the molecular formula C7H11N3S
and a molecular weight of 169.25 g/mol. Its IUPAC name is 4-cyclopentyl-1H-1,2,4-triazole-5-thione.
Molecular Properties
| Compound Name | 4-cyclopentyl-1H-1,2,4-triazole-5-thione |
| PubChem CID | 29064874 |
| Molecular Formula | C7H11N3S |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 4-cyclopentyl-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]ncn1C1CCCC1 |
| InChI | InChI=1S/C7H11N3S/c11-7-9-8-5-10(7)6-3-1-2-4-6/h5-6H,1-4H2,(H,9,11) |
| InChIKey | FJEZKBOFSPLWGL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclopentyl-1H-1,2,4-triazole-5-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopentyl-1H-1,2,4-triazole-5-thione?
The IUPAC name of 4-cyclopentyl-1H-1,2,4-triazole-5-thione (CID 29064874) is 4-cyclopentyl-1H-1,2,4-triazole-5-thione.
What is the SMILES notation for 4-cyclopentyl-1H-1,2,4-triazole-5-thione?
The canonical SMILES for 4-cyclopentyl-1H-1,2,4-triazole-5-thione is S=c1[nH]ncn1C1CCCC1.
What is the InChIKey of 4-cyclopentyl-1H-1,2,4-triazole-5-thione?
The InChIKey is FJEZKBOFSPLWGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3S/c11-7-9-8-5-10(7)6-3-1-2-4-6/h5-6H,1-4H2,(H,9,11).
What are the key properties of 4-cyclopentyl-1H-1,2,4-triazole-5-thione?
4-cyclopentyl-1H-1,2,4-triazole-5-thione has a molecular weight of 169.25 g/mol, XLogP of 2.06, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopentyl-1H-1,2,4-triazole-5-thione is sourced from PubChem (CID 29064874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).