C14H17ClN2O5 — CID 29065
1H-imidazol-3-ium-5-ylmethyl 3,4,5-trimethoxybenzoate chloride (PubChem CID 29065) has the molecular formula C14H17ClN2O5 and a molecular weight of 328.75 g/mol. Its IUPAC name is 1H-imidazol-3-ium-5-ylmethyl 3,4,5-trimethoxybenzoate chloride.
| Compound Name | 1H-imidazol-3-ium-5-ylmethyl 3,4,5-trimethoxybenzoate chloride |
|---|---|
| PubChem CID | 29065 |
| Molecular Formula | C14H17ClN2O5 |
| Molecular Weight | 328.75 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 1H-imidazol-3-ium-5-ylmethyl 3,4,5-trimethoxybenzoate chloride |
| SMILES | COc1cc(C(=O)OCc2c[nH+]c[nH]2)cc(OC)c1OC.[Cl-] |
| InChI | InChI=1S/C14H16N2O5.ClH/c1-18-11-4-9(5-12(19-2)13(11)20-3)14(17)21-7-10-6-15-8-16-10;/h4-6,8H,7H2,1-3H3,(H,15,16);1H |
| InChIKey | LLFHOORQLLXOOM-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.75 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |