C12H13N3O3S — CID 29065222
2-[[4-(2-ethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid (PubChem CID 29065222) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is 2-[[4-(2-ethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[4-(2-ethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 29065222 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 2-[[4-(2-ethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| SMILES | CCOc1ccccc1-n1cnnc1SCC(=O)O |
| InChI | InChI=1S/C12H13N3O3S/c1-2-18-10-6-4-3-5-9(10)15-8-13-14-12(15)19-7-11(16)17/h3-6,8H,2,7H2,1H3,(H,16,17) |
| InChIKey | WCIMVZXIAKMZFU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |