About 6-(2,4-dichlorophenyl)-5-nitropiperidin-2-one
6-(2,4-dichlorophenyl)-5-nitropiperidin-2-one (PubChem CID 2906626) has the molecular formula C11H10Cl2N2O3
and a molecular weight of 289.12 g/mol. Its IUPAC name is 6-(2,4-dichlorophenyl)-5-nitropiperidin-2-one.
Molecular Properties
| Compound Name | 6-(2,4-dichlorophenyl)-5-nitropiperidin-2-one |
| PubChem CID | 2906626 |
| Molecular Formula | C11H10Cl2N2O3 |
| Molecular Weight | 289.12 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 6-(2,4-dichlorophenyl)-5-nitropiperidin-2-one |
| SMILES | O=C1CCC([N+](=O)[O-])C(c2ccc(Cl)cc2Cl)N1 |
| InChI | InChI=1S/C11H10Cl2N2O3/c12-6-1-2-7(8(13)5-6)11-9(15(17)18)3-4-10(16)14-11/h1-2,5,9,11H,3-4H2,(H,14,16) |
| InChIKey | GDAHCVIMQPMWKX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.12 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,4-dichlorophenyl)-5-nitropiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,4-dichlorophenyl)-5-nitropiperidin-2-one?
The IUPAC name of 6-(2,4-dichlorophenyl)-5-nitropiperidin-2-one (CID 2906626) is 6-(2,4-dichlorophenyl)-5-nitropiperidin-2-one.
What is the SMILES notation for 6-(2,4-dichlorophenyl)-5-nitropiperidin-2-one?
The canonical SMILES for 6-(2,4-dichlorophenyl)-5-nitropiperidin-2-one is O=C1CCC([N+](=O)[O-])C(c2ccc(Cl)cc2Cl)N1.
What is the InChIKey of 6-(2,4-dichlorophenyl)-5-nitropiperidin-2-one?
The InChIKey is GDAHCVIMQPMWKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10Cl2N2O3/c12-6-1-2-7(8(13)5-6)11-9(15(17)18)3-4-10(16)14-11/h1-2,5,9,11H,3-4H2,(H,14,16).
What are the key properties of 6-(2,4-dichlorophenyl)-5-nitropiperidin-2-one?
6-(2,4-dichlorophenyl)-5-nitropiperidin-2-one has a molecular weight of 289.12 g/mol, XLogP of 2.59, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,4-dichlorophenyl)-5-nitropiperidin-2-one is sourced from PubChem (CID 2906626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).