C12H12ClN3 — CID 29066314
4-N-(3-chloro-4-methylphenyl)pyridine-3,4-diamine (PubChem CID 29066314) has the molecular formula C12H12ClN3 and a molecular weight of 233.70 g/mol. Its IUPAC name is 4-N-(3-chloro-4-methylphenyl)pyridine-3,4-diamine.
| Compound Name | 4-N-(3-chloro-4-methylphenyl)pyridine-3,4-diamine |
|---|---|
| PubChem CID | 29066314 |
| Molecular Formula | C12H12ClN3 |
| Molecular Weight | 233.70 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 4-N-(3-chloro-4-methylphenyl)pyridine-3,4-diamine |
| SMILES | Cc1ccc(Nc2ccncc2N)cc1Cl |
| InChI | InChI=1S/C12H12ClN3/c1-8-2-3-9(6-10(8)13)16-12-4-5-15-7-11(12)14/h2-7H,14H2,1H3,(H,15,16) |
| InChIKey | WMZGNYNELYTZSI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.70 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |